C10H16O5 — CID 78099434
ethyl 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-oxopropanoate (PubChem CID 78099434) has the molecular formula C10H16O5 and a molecular weight of 216.23 g/mol. Its IUPAC name is ethyl 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-oxopropanoate.
| Compound Name | ethyl 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-oxopropanoate |
|---|---|
| PubChem CID | 78099434 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | ethyl 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-oxopropanoate |
| SMILES | CCOC(=O)C(=O)CC1COC(C)(C)O1 |
| InChI | InChI=1S/C10H16O5/c1-4-13-9(12)8(11)5-7-6-14-10(2,3)15-7/h7H,4-6H2,1-3H3 |
| InChIKey | QOEBQPHGJGOOLE-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|