C14H20O4S2 — CID 15534149
diethyl 5-methyl-2-prop-1-en-2-yl-4H-1,3-dithiine-2,6-dicarboxylate (PubChem CID 15534149) has the molecular formula C14H20O4S2 and a molecular weight of 316.44 g/mol. Its IUPAC name is diethyl 5-methyl-2-prop-1-en-2-yl-4H-1,3-dithiine-2,6-dicarboxylate.
| Compound Name | diethyl 5-methyl-2-prop-1-en-2-yl-4H-1,3-dithiine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 15534149 |
| Molecular Formula | C14H20O4S2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | diethyl 5-methyl-2-prop-1-en-2-yl-4H-1,3-dithiine-2,6-dicarboxylate |
| SMILES | C=C(C)C1(C(=O)OCC)SCC(C)=C(C(=O)OCC)S1 |
| InChI | InChI=1S/C14H20O4S2/c1-6-17-12(15)11-10(5)8-19-14(20-11,9(3)4)13(16)18-7-2/h3,6-8H2,1-2,4-5H3 |
| InChIKey | MMVKVPXASFOPSJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|