C10H16O6S2 — CID 24749363
diethyl (2R,5S)-2,5-dihydroxy-1,4-dithiane-2,5-dicarboxylate (PubChem CID 24749363) has the molecular formula C10H16O6S2 and a molecular weight of 296.37 g/mol. Its IUPAC name is diethyl (2R,5S)-2,5-dihydroxy-1,4-dithiane-2,5-dicarboxylate.
| Compound Name | diethyl (2R,5S)-2,5-dihydroxy-1,4-dithiane-2,5-dicarboxylate |
|---|---|
| PubChem CID | 24749363 |
| Molecular Formula | C10H16O6S2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | diethyl (2R,5S)-2,5-dihydroxy-1,4-dithiane-2,5-dicarboxylate |
| SMILES | CCOC(=O)[C@@]1(O)CS[C@](O)(C(=O)OCC)CS1 |
| InChI | InChI=1S/C10H16O6S2/c1-3-15-7(11)9(13)5-18-10(14,6-17-9)8(12)16-4-2/h13-14H,3-6H2,1-2H3/t9-,10+ |
| InChIKey | HEPGDTBVAQJAOL-AOOOYVTPSA-N |
| XLogP | -0.03 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |