C7H11NO4S — CID 124638730
(4R)-4-ethoxycarbonyl-1,2-thiazolidine-4-carboxylic acid (PubChem CID 124638730) has the molecular formula C7H11NO4S and a molecular weight of 205.23 g/mol. Its IUPAC name is (4R)-4-ethoxycarbonyl-1,2-thiazolidine-4-carboxylic acid.
| Compound Name | (4R)-4-ethoxycarbonyl-1,2-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 124638730 |
| Molecular Formula | C7H11NO4S |
| Molecular Weight | 205.23 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | (4R)-4-ethoxycarbonyl-1,2-thiazolidine-4-carboxylic acid |
| SMILES | CCOC(=O)[C@]1(C(=O)O)CNSC1 |
| InChI | InChI=1S/C7H11NO4S/c1-2-12-6(11)7(5(9)10)3-8-13-4-7/h8H,2-4H2,1H3,(H,9,10)/t7-/m1/s1 |
| InChIKey | MDYWIBCWALPKGJ-SSDOTTSWSA-N |
| XLogP | -0.13 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.23 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|