2-ethoxycarbonyl-4,4-dimethylpiperidine-2-carboxylic acid

C11H19NO4 — CID 67835245

IUPAC2-ethoxycarbonyl-4,4-dimethylpiperidine-2-carboxylic acid
SMILESCCOC(=O)C1(C(=O)O)CC(C)(C)CCN1
InChIInChI=1S/C11H19NO4/c1-4-16-9(15)11(8(13)14)7-10(2,3)5-6-12-11/h12H,4-7H2,1-3H3,(H,13,14)
InChIKeyFYWRNVKYZISAQS-UHFFFAOYSA-N
MW229.28 g/mol
LogP0.78
Rot. Bonds3

About 2-ethoxycarbonyl-4,4-dimethylpiperidine-2-carboxylic acid

2-ethoxycarbonyl-4,4-dimethylpiperidine-2-carboxylic acid (PubChem CID 67835245) has the molecular formula C11H19NO4 and a molecular weight of 229.28 g/mol. Its IUPAC name is 2-ethoxycarbonyl-4,4-dimethylpiperidine-2-carboxylic acid.

Molecular Properties

Compound Name2-ethoxycarbonyl-4,4-dimethylpiperidine-2-carboxylic acid
PubChem CID67835245
Molecular FormulaC11H19NO4
Molecular Weight229.28 g/mol
Exact Mass229.13
IUPAC Name2-ethoxycarbonyl-4,4-dimethylpiperidine-2-carboxylic acid
SMILESCCOC(=O)C1(C(=O)O)CC(C)(C)CCN1
InChIInChI=1S/C11H19NO4/c1-4-16-9(15)11(8(13)14)7-10(2,3)5-6-12-11/h12H,4-7H2,1-3H3,(H,13,14)
InChIKeyFYWRNVKYZISAQS-UHFFFAOYSA-N
XLogP0.78
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.28
LogP ≤ 50.78
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 2-ethoxycarbonyl-4,4-dimethylpiperidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethoxycarbonyl-4,4-dimethylpiperidine-2-carboxylic acid?
The IUPAC name of 2-ethoxycarbonyl-4,4-dimethylpiperidine-2-carboxylic acid (CID 67835245) is 2-ethoxycarbonyl-4,4-dimethylpiperidine-2-carboxylic acid.
What is the SMILES notation for 2-ethoxycarbonyl-4,4-dimethylpiperidine-2-carboxylic acid?
The canonical SMILES for 2-ethoxycarbonyl-4,4-dimethylpiperidine-2-carboxylic acid is CCOC(=O)C1(C(=O)O)CC(C)(C)CCN1.
What is the InChIKey of 2-ethoxycarbonyl-4,4-dimethylpiperidine-2-carboxylic acid?
The InChIKey is FYWRNVKYZISAQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO4/c1-4-16-9(15)11(8(13)14)7-10(2,3)5-6-12-11/h12H,4-7H2,1-3H3,(H,13,14).
What are the key properties of 2-ethoxycarbonyl-4,4-dimethylpiperidine-2-carboxylic acid?
2-ethoxycarbonyl-4,4-dimethylpiperidine-2-carboxylic acid has a molecular weight of 229.28 g/mol, XLogP of 0.78, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxycarbonyl-4,4-dimethylpiperidine-2-carboxylic acid is sourced from PubChem (CID 67835245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).