About 1-O-ethyl 2-O-propyl 1,2,4,4-tetramethylcyclohexane-1,2-dicarboxylate
1-O-ethyl 2-O-propyl 1,2,4,4-tetramethylcyclohexane-1,2-dicarboxylate (PubChem CID 146562618) has the molecular formula C17H30O4
and a molecular weight of 298.42 g/mol. Its IUPAC name is 1-O-ethyl 2-O-propyl 1,2,4,4-tetramethylcyclohexane-1,2-dicarboxylate.
Analyze 1-O-ethyl 2-O-propyl 1,2,4,4-tetramethylcyclohexane-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 2-O-propyl 1,2,4,4-tetramethylcyclohexane-1,2-dicarboxylate?
The IUPAC name of 1-O-ethyl 2-O-propyl 1,2,4,4-tetramethylcyclohexane-1,2-dicarboxylate (CID 146562618) is 1-O-ethyl 2-O-propyl 1,2,4,4-tetramethylcyclohexane-1,2-dicarboxylate.
What is the SMILES notation for 1-O-ethyl 2-O-propyl 1,2,4,4-tetramethylcyclohexane-1,2-dicarboxylate?
The canonical SMILES for 1-O-ethyl 2-O-propyl 1,2,4,4-tetramethylcyclohexane-1,2-dicarboxylate is CCCOC(=O)C1(C)CC(C)(C)CCC1(C)C(=O)OCC.
What is the InChIKey of 1-O-ethyl 2-O-propyl 1,2,4,4-tetramethylcyclohexane-1,2-dicarboxylate?
The InChIKey is POYUWSLFHOWBII-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30O4/c1-7-11-21-14(19)17(6)12-15(3,4)9-10-16(17,5)13(18)20-8-2/h7-12H2,1-6H3.
What are the key properties of 1-O-ethyl 2-O-propyl 1,2,4,4-tetramethylcyclohexane-1,2-dicarboxylate?
1-O-ethyl 2-O-propyl 1,2,4,4-tetramethylcyclohexane-1,2-dicarboxylate has a molecular weight of 298.42 g/mol, XLogP of 3.73, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 2-O-propyl 1,2,4,4-tetramethylcyclohexane-1,2-dicarboxylate is sourced from PubChem (CID 146562618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).