C7H10BrIO2 — CID 11325057
cis-ethyl (1R,2S)-2-bromo-2-iodo-1-methylcyclopropane-1-carboxylate (PubChem CID 11325057) has the molecular formula C7H10BrIO2 and a molecular weight of 332.96 g/mol. Its IUPAC name is cis-ethyl (1R,2S)-2-bromo-2-iodo-1-methylcyclopropane-1-carboxylate.
| Compound Name | cis-ethyl (1R,2S)-2-bromo-2-iodo-1-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 11325057 |
| Molecular Formula | C7H10BrIO2 |
| Molecular Weight | 332.96 g/mol |
| Exact Mass | 331.89 |
| IUPAC Name | cis-ethyl (1R,2S)-2-bromo-2-iodo-1-methylcyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C)C[C@]1(Br)I |
| InChI | InChI=1S/C7H10BrIO2/c1-3-11-5(10)6(2)4-7(6,8)9/h3-4H2,1-2H3/t6-,7+/m1/s1 |
| InChIKey | RTUNLECWQUVWAM-RQJHMYQMSA-N |
| XLogP | 2.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.96 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|