C13H21NO2 — CID 80700136
ethyl 3,3-dimethyl-1-(prop-2-ynylamino)cyclopentane-1-carboxylate (PubChem CID 80700136) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is ethyl 3,3-dimethyl-1-(prop-2-ynylamino)cyclopentane-1-carboxylate.
| Compound Name | ethyl 3,3-dimethyl-1-(prop-2-ynylamino)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 80700136 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | ethyl 3,3-dimethyl-1-(prop-2-ynylamino)cyclopentane-1-carboxylate |
| SMILES | C#CCNC1(C(=O)OCC)CCC(C)(C)C1 |
| InChI | InChI=1S/C13H21NO2/c1-5-9-14-13(11(15)16-6-2)8-7-12(3,4)10-13/h1,14H,6-10H2,2-4H3 |
| InChIKey | YFPBCZXUKNNPCH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|