About acetic acid;ethyl 1-ethenylcyclopropane-1-carboxylate
acetic acid;ethyl 1-ethenylcyclopropane-1-carboxylate (PubChem CID 67925632) has the molecular formula C10H16O4
and a molecular weight of 200.23 g/mol. Its IUPAC name is acetic acid;ethyl 1-ethenylcyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | acetic acid;ethyl 1-ethenylcyclopropane-1-carboxylate |
| PubChem CID | 67925632 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | acetic acid;ethyl 1-ethenylcyclopropane-1-carboxylate |
| SMILES | C=CC1(C(=O)OCC)CC1.CC(=O)O |
| InChI | InChI=1S/C8H12O2.C2H4O2/c1-3-8(5-6-8)7(9)10-4-2;1-2(3)4/h3H,1,4-6H2,2H3;1H3,(H,3,4) |
| InChIKey | HHQKXTVUSTYLEJ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;ethyl 1-ethenylcyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;ethyl 1-ethenylcyclopropane-1-carboxylate?
The IUPAC name of acetic acid;ethyl 1-ethenylcyclopropane-1-carboxylate (CID 67925632) is acetic acid;ethyl 1-ethenylcyclopropane-1-carboxylate.
What is the SMILES notation for acetic acid;ethyl 1-ethenylcyclopropane-1-carboxylate?
The canonical SMILES for acetic acid;ethyl 1-ethenylcyclopropane-1-carboxylate is C=CC1(C(=O)OCC)CC1.CC(=O)O.
What is the InChIKey of acetic acid;ethyl 1-ethenylcyclopropane-1-carboxylate?
The InChIKey is HHQKXTVUSTYLEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O2.C2H4O2/c1-3-8(5-6-8)7(9)10-4-2;1-2(3)4/h3H,1,4-6H2,2H3;1H3,(H,3,4).
What are the key properties of acetic acid;ethyl 1-ethenylcyclopropane-1-carboxylate?
acetic acid;ethyl 1-ethenylcyclopropane-1-carboxylate has a molecular weight of 200.23 g/mol, XLogP of 1.61, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;ethyl 1-ethenylcyclopropane-1-carboxylate is sourced from PubChem (CID 67925632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).