C6H8N2O2S — CID 97050355
ethyl 2-sulfanylidene-1,5-dihydroimidazole-4-carboxylate (PubChem CID 97050355) has the molecular formula C6H8N2O2S and a molecular weight of 172.21 g/mol. Its IUPAC name is ethyl 2-sulfanylidene-1,5-dihydroimidazole-4-carboxylate.
| Compound Name | ethyl 2-sulfanylidene-1,5-dihydroimidazole-4-carboxylate |
|---|---|
| PubChem CID | 97050355 |
| Molecular Formula | C6H8N2O2S |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | ethyl 2-sulfanylidene-1,5-dihydroimidazole-4-carboxylate |
| SMILES | CCOC(=O)C1=NC(=S)NC1 |
| InChI | InChI=1S/C6H8N2O2S/c1-2-10-5(9)4-3-7-6(11)8-4/h2-3H2,1H3,(H,7,11) |
| InChIKey | MXCCUEOSUJRPDV-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|