About ethane;ethyl 1H-imidazole-2-carboxylate
ethane;ethyl 1H-imidazole-2-carboxylate (PubChem CID 143717895) has the molecular formula C10H20N2O2
and a molecular weight of 200.28 g/mol. Its IUPAC name is ethane;ethyl 1H-imidazole-2-carboxylate.
Molecular Properties
| Compound Name | ethane;ethyl 1H-imidazole-2-carboxylate |
| PubChem CID | 143717895 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | ethane;ethyl 1H-imidazole-2-carboxylate |
| SMILES | CC.CC.CCOC(=O)c1ncc[nH]1 |
| InChI | InChI=1S/C6H8N2O2.2C2H6/c1-2-10-6(9)5-7-3-4-8-5;2*1-2/h3-4H,2H2,1H3,(H,7,8);2*1-2H3 |
| InChIKey | WTEQKFRSBRPQSI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;ethyl 1H-imidazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethyl 1H-imidazole-2-carboxylate?
The IUPAC name of ethane;ethyl 1H-imidazole-2-carboxylate (CID 143717895) is ethane;ethyl 1H-imidazole-2-carboxylate.
What is the SMILES notation for ethane;ethyl 1H-imidazole-2-carboxylate?
The canonical SMILES for ethane;ethyl 1H-imidazole-2-carboxylate is CC.CC.CCOC(=O)c1ncc[nH]1.
What is the InChIKey of ethane;ethyl 1H-imidazole-2-carboxylate?
The InChIKey is WTEQKFRSBRPQSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2.2C2H6/c1-2-10-6(9)5-7-3-4-8-5;2*1-2/h3-4H,2H2,1H3,(H,7,8);2*1-2H3.
What are the key properties of ethane;ethyl 1H-imidazole-2-carboxylate?
ethane;ethyl 1H-imidazole-2-carboxylate has a molecular weight of 200.28 g/mol, XLogP of 2.64, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethyl 1H-imidazole-2-carboxylate is sourced from PubChem (CID 143717895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).