C10H17N3O — CID 142565900
but-1-yne;methane;N-methyl-1H-imidazole-2-carboxamide (PubChem CID 142565900) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is but-1-yne;methane;N-methyl-1H-imidazole-2-carboxamide.
| Compound Name | but-1-yne;methane;N-methyl-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 142565900 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | but-1-yne;methane;N-methyl-1H-imidazole-2-carboxamide |
| SMILES | C.C#CCC.CNC(=O)c1ncc[nH]1 |
| InChI | InChI=1S/C5H7N3O.C4H6.CH4/c1-6-5(9)4-7-2-3-8-4;1-3-4-2;/h2-3H,1H3,(H,6,9)(H,7,8);1H,4H2,2H3;1H4 |
| InChIKey | FAIOACKGBSWATE-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|