About azane;cobalt;1H-imidazole-2-carboxylic acid
azane;cobalt;1H-imidazole-2-carboxylic acid (PubChem CID 175883152) has the molecular formula C4H7CoN3O2
and a molecular weight of 188.05 g/mol. Its IUPAC name is azane;cobalt;1H-imidazole-2-carboxylic acid.
Molecular Properties
| Compound Name | azane;cobalt;1H-imidazole-2-carboxylic acid |
| PubChem CID | 175883152 |
| Molecular Formula | C4H7CoN3O2 |
| Molecular Weight | 188.05 g/mol |
| Exact Mass | 187.99 |
| IUPAC Name | azane;cobalt;1H-imidazole-2-carboxylic acid |
| SMILES | N.O=C(O)c1ncc[nH]1.[Co] |
| InChI | InChI=1S/C4H4N2O2.Co.H3N/c7-4(8)3-5-1-2-6-3;;/h1-2H,(H,5,6)(H,7,8);;1H3 |
| InChIKey | YYNWZWTZJKLVFH-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.05 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azane;cobalt;1H-imidazole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;cobalt;1H-imidazole-2-carboxylic acid?
The IUPAC name of azane;cobalt;1H-imidazole-2-carboxylic acid (CID 175883152) is azane;cobalt;1H-imidazole-2-carboxylic acid.
What is the SMILES notation for azane;cobalt;1H-imidazole-2-carboxylic acid?
The canonical SMILES for azane;cobalt;1H-imidazole-2-carboxylic acid is N.O=C(O)c1ncc[nH]1.[Co].
What is the InChIKey of azane;cobalt;1H-imidazole-2-carboxylic acid?
The InChIKey is YYNWZWTZJKLVFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2O2.Co.H3N/c7-4(8)3-5-1-2-6-3;;/h1-2H,(H,5,6)(H,7,8);;1H3.
What are the key properties of azane;cobalt;1H-imidazole-2-carboxylic acid?
azane;cobalt;1H-imidazole-2-carboxylic acid has a molecular weight of 188.05 g/mol, XLogP of 0.27, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;cobalt;1H-imidazole-2-carboxylic acid is sourced from PubChem (CID 175883152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).