C9H12N2O4S — CID 4271345
diethyl 2-sulfanylidene-1,3-dihydroimidazole-4,5-dicarboxylate (PubChem CID 4271345) has the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. Its IUPAC name is diethyl 2-sulfanylidene-1,3-dihydroimidazole-4,5-dicarboxylate.
| Compound Name | diethyl 2-sulfanylidene-1,3-dihydroimidazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 4271345 |
| Molecular Formula | C9H12N2O4S |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | diethyl 2-sulfanylidene-1,3-dihydroimidazole-4,5-dicarboxylate |
| SMILES | CCOC(=O)c1[nH]c(=S)[nH]c1C(=O)OCC |
| InChI | InChI=1S/C9H12N2O4S/c1-3-14-7(12)5-6(8(13)15-4-2)11-9(16)10-5/h3-4H2,1-2H3,(H2,10,11,16) |
| InChIKey | WSUPBCLPPKCHHU-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 84.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|