C13H19N3O4S — CID 22756835
aziridine;diethyl 2-methyl-4-sulfanylidene-1H-pyrimidine-5,6-dicarboxylate (PubChem CID 22756835) has the molecular formula C13H19N3O4S and a molecular weight of 313.38 g/mol. Its IUPAC name is aziridine;diethyl 2-methyl-4-sulfanylidene-1H-pyrimidine-5,6-dicarboxylate.
| Compound Name | aziridine;diethyl 2-methyl-4-sulfanylidene-1H-pyrimidine-5,6-dicarboxylate |
|---|---|
| PubChem CID | 22756835 |
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | aziridine;diethyl 2-methyl-4-sulfanylidene-1H-pyrimidine-5,6-dicarboxylate |
| SMILES | C1CN1.CCOC(=O)c1[nH]c(C)nc(=S)c1C(=O)OCC |
| InChI | InChI=1S/C11H14N2O4S.C2H5N/c1-4-16-10(14)7-8(11(15)17-5-2)12-6(3)13-9(7)18;1-2-3-1/h4-5H2,1-3H3,(H,12,13,18);3H,1-2H2 |
| InChIKey | GEKANQFXHXKVSY-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 103.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|