C7H10ClNO3 — CID 156692971
ethyl 3-chloro-5-methyl-4H-1,2-oxazole-5-carboxylate (PubChem CID 156692971) has the molecular formula C7H10ClNO3 and a molecular weight of 191.61 g/mol. Its IUPAC name is ethyl 3-chloro-5-methyl-4H-1,2-oxazole-5-carboxylate.
| Compound Name | ethyl 3-chloro-5-methyl-4H-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 156692971 |
| Molecular Formula | C7H10ClNO3 |
| Molecular Weight | 191.61 g/mol |
| Exact Mass | 191.03 |
| IUPAC Name | ethyl 3-chloro-5-methyl-4H-1,2-oxazole-5-carboxylate |
| SMILES | CCOC(=O)C1(C)CC(Cl)=NO1 |
| InChI | InChI=1S/C7H10ClNO3/c1-3-11-6(10)7(2)4-5(8)9-12-7/h3-4H2,1-2H3 |
| InChIKey | ZODVTPQCLZSFHF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.61 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |