C19H20N2O3 — CID 175392819
2-aminopropan-2-yl 5,5-diphenyl-4H-1,2-oxazole-3-carboxylate (PubChem CID 175392819) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-aminopropan-2-yl 5,5-diphenyl-4H-1,2-oxazole-3-carboxylate.
| Compound Name | 2-aminopropan-2-yl 5,5-diphenyl-4H-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 175392819 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 2-aminopropan-2-yl 5,5-diphenyl-4H-1,2-oxazole-3-carboxylate |
| SMILES | CC(C)(N)OC(=O)C1=NOC(c2ccccc2)(c2ccccc2)C1 |
| InChI | InChI=1S/C19H20N2O3/c1-18(2,20)23-17(22)16-13-19(24-21-16,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12H,13,20H2,1-2H3 |
| InChIKey | JVEJBQTUCBMVHL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|