C13H15NO5 — CID 15474022
tert-butyl (1'S,5S,6'R)-5'-oxospiro[4H-1,2-oxazole-5,2'-7-oxabicyclo[4.1.0]hept-3-ene]-3-carboxylate (PubChem CID 15474022) has the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. Its IUPAC name is tert-butyl (1'S,5S,6'R)-5'-oxospiro[4H-1,2-oxazole-5,2'-7-oxabicyclo[4.1.0]hept-3-ene]-3-carboxylate.
| Compound Name | tert-butyl (1'S,5S,6'R)-5'-oxospiro[4H-1,2-oxazole-5,2'-7-oxabicyclo[4.1.0]hept-3-ene]-3-carboxylate |
|---|---|
| PubChem CID | 15474022 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | tert-butyl (1'S,5S,6'R)-5'-oxospiro[4H-1,2-oxazole-5,2'-7-oxabicyclo[4.1.0]hept-3-ene]-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1=NO[C@]2(C=CC(=O)[C@@H]3O[C@@H]32)C1 |
| InChI | InChI=1S/C13H15NO5/c1-12(2,3)18-11(16)7-6-13(19-14-7)5-4-8(15)9-10(13)17-9/h4-5,9-10H,6H2,1-3H3/t9-,10-,13+/m0/s1 |
| InChIKey | CQRNOVWZYYHCNT-OUJBWJOFSA-N |
| XLogP | 0.75 |
| TPSA | 77.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|