About tert-butyl oxazepine-3-carboxylate
tert-butyl oxazepine-3-carboxylate (PubChem CID 150683542) has the molecular formula C10H13NO3
and a molecular weight of 195.22 g/mol. Its IUPAC name is tert-butyl oxazepine-3-carboxylate.
Molecular Properties
| Compound Name | tert-butyl oxazepine-3-carboxylate |
| PubChem CID | 150683542 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | tert-butyl oxazepine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1=NOC=CC=C1 |
| InChI | InChI=1S/C10H13NO3/c1-10(2,3)14-9(12)8-6-4-5-7-13-11-8/h4-7H,1-3H3 |
| InChIKey | JIJMHYXXKDSHET-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl oxazepine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl oxazepine-3-carboxylate?
The IUPAC name of tert-butyl oxazepine-3-carboxylate (CID 150683542) is tert-butyl oxazepine-3-carboxylate.
What is the SMILES notation for tert-butyl oxazepine-3-carboxylate?
The canonical SMILES for tert-butyl oxazepine-3-carboxylate is CC(C)(C)OC(=O)C1=NOC=CC=C1.
What is the InChIKey of tert-butyl oxazepine-3-carboxylate?
The InChIKey is JIJMHYXXKDSHET-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3/c1-10(2,3)14-9(12)8-6-4-5-7-13-11-8/h4-7H,1-3H3.
What are the key properties of tert-butyl oxazepine-3-carboxylate?
tert-butyl oxazepine-3-carboxylate has a molecular weight of 195.22 g/mol, XLogP of 1.78, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl oxazepine-3-carboxylate is sourced from PubChem (CID 150683542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).