C30H46O10 — CID 155930446
tetratert-butyl (3aS,6aS)-2,5-dimethoxy-1,3a,4,6a-tetrahydropentalene-1,3,4,6-tetracarboxylate (PubChem CID 155930446) has the molecular formula C30H46O10 and a molecular weight of 566.69 g/mol. Its IUPAC name is tetratert-butyl (3aS,6aS)-2,5-dimethoxy-1,3a,4,6a-tetrahydropentalene-1,3,4,6-tetracarboxylate.
| Compound Name | tetratert-butyl (3aS,6aS)-2,5-dimethoxy-1,3a,4,6a-tetrahydropentalene-1,3,4,6-tetracarboxylate |
|---|---|
| PubChem CID | 155930446 |
| Molecular Formula | C30H46O10 |
| Molecular Weight | 566.69 g/mol |
| Exact Mass | 566.31 |
| IUPAC Name | tetratert-butyl (3aS,6aS)-2,5-dimethoxy-1,3a,4,6a-tetrahydropentalene-1,3,4,6-tetracarboxylate |
| SMILES | COC1=C(C(=O)OC(C)(C)C)[C@@H]2C(C(=O)OC(C)(C)C)C(OC)=C(C(=O)OC(C)(C)C)[C@@H]2C1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H46O10/c1-27(2,3)37-23(31)17-15-16(19(21(17)35-13)25(33)39-29(7,8)9)20(26(34)40-30(10,11)12)22(36-14)18(15)24(32)38-28(4,5)6/h15-17,20H,1-14H3/t15-,16+,17?,20?/m0/s1 |
| InChIKey | BJGQBCYIROXAMY-RIGHFQGKSA-N |
| XLogP | 4.65 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.69 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|