C16H23NO4Si — CID 14688503
ethyl 6-phenyl-6-trimethylsilyloxy-4,5-dihydrooxazine-3-carboxylate (PubChem CID 14688503) has the molecular formula C16H23NO4Si and a molecular weight of 321.45 g/mol. Its IUPAC name is ethyl 6-phenyl-6-trimethylsilyloxy-4,5-dihydrooxazine-3-carboxylate.
| Compound Name | ethyl 6-phenyl-6-trimethylsilyloxy-4,5-dihydrooxazine-3-carboxylate |
|---|---|
| PubChem CID | 14688503 |
| Molecular Formula | C16H23NO4Si |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | ethyl 6-phenyl-6-trimethylsilyloxy-4,5-dihydrooxazine-3-carboxylate |
| SMILES | CCOC(=O)C1=NOC(O[Si](C)(C)C)(c2ccccc2)CC1 |
| InChI | InChI=1S/C16H23NO4Si/c1-5-19-15(18)14-11-12-16(20-17-14,21-22(2,3)4)13-9-7-6-8-10-13/h6-10H,5,11-12H2,1-4H3 |
| InChIKey | WIVMYHIVDRQNAA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|