C14H25NO4Si — CID 14590245
ethyl 8a-trimethylsilyloxy-4,4a,5,6,7,8-hexahydro-1,2-benzoxazine-3-carboxylate (PubChem CID 14590245) has the molecular formula C14H25NO4Si and a molecular weight of 299.44 g/mol. Its IUPAC name is ethyl 8a-trimethylsilyloxy-4,4a,5,6,7,8-hexahydro-1,2-benzoxazine-3-carboxylate.
| Compound Name | ethyl 8a-trimethylsilyloxy-4,4a,5,6,7,8-hexahydro-1,2-benzoxazine-3-carboxylate |
|---|---|
| PubChem CID | 14590245 |
| Molecular Formula | C14H25NO4Si |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | ethyl 8a-trimethylsilyloxy-4,4a,5,6,7,8-hexahydro-1,2-benzoxazine-3-carboxylate |
| SMILES | CCOC(=O)C1=NOC2(O[Si](C)(C)C)CCCCC2C1 |
| InChI | InChI=1S/C14H25NO4Si/c1-5-17-13(16)12-10-11-8-6-7-9-14(11,18-15-12)19-20(2,3)4/h11H,5-10H2,1-4H3 |
| InChIKey | VNGVIKZNLZYNIS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|