C31H36N2O4S — CID 87380016
S-benzyl N-ethyl-N-(3-methylbutan-2-yl)carbamothioate;5,5-diphenyl-4H-1,2-oxazole-3-carboxylic acid (PubChem CID 87380016) has the molecular formula C31H36N2O4S and a molecular weight of 532.71 g/mol. Its IUPAC name is S-benzyl N-ethyl-N-(3-methylbutan-2-yl)carbamothioate;5,5-diphenyl-4H-1,2-oxazole-3-carboxylic acid.
| Compound Name | S-benzyl N-ethyl-N-(3-methylbutan-2-yl)carbamothioate;5,5-diphenyl-4H-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 87380016 |
| Molecular Formula | C31H36N2O4S |
| Molecular Weight | 532.71 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | S-benzyl N-ethyl-N-(3-methylbutan-2-yl)carbamothioate;5,5-diphenyl-4H-1,2-oxazole-3-carboxylic acid |
| SMILES | CCN(C(=O)SCc1ccccc1)C(C)C(C)C.O=C(O)C1=NOC(c2ccccc2)(c2ccccc2)C1 |
| InChI | InChI=1S/C16H13NO3.C15H23NOS/c18-15(19)14-11-16(20-17-14,12-7-3-1-4-8-12)13-9-5-2-6-10-13;1-5-16(13(4)12(2)3)15(17)18-11-14-9-7-6-8-10-14/h1-10H,11H2,(H,18,19);6-10,12-13H,5,11H2,1-4H3 |
| InChIKey | VVHQBPGYGJPGIY-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.71 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|