C26H24N2O2 — CID 101194388
ethyl 2-amino-5-(4-methylphenyl)-4,4-diphenylpyrrole-3-carboxylate (PubChem CID 101194388) has the molecular formula C26H24N2O2 and a molecular weight of 396.49 g/mol. Its IUPAC name is ethyl 2-amino-5-(4-methylphenyl)-4,4-diphenylpyrrole-3-carboxylate.
| Compound Name | ethyl 2-amino-5-(4-methylphenyl)-4,4-diphenylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 101194388 |
| Molecular Formula | C26H24N2O2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | ethyl 2-amino-5-(4-methylphenyl)-4,4-diphenylpyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1=C(N)N=C(c2ccc(C)cc2)C1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H24N2O2/c1-3-30-25(29)22-24(27)28-23(19-16-14-18(2)15-17-19)26(22,20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-17H,3,27H2,1-2H3 |
| InChIKey | OAACSCKFNNOJER-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |