C22H26O5 — CID 100975633
diethyl (3aR,5R)-5-methyl-6-oxo-7-phenyl-3,3a,4,5-tetrahydro-1H-indene-2,2-dicarboxylate (PubChem CID 100975633) has the molecular formula C22H26O5 and a molecular weight of 370.45 g/mol. Its IUPAC name is diethyl (3aR,5R)-5-methyl-6-oxo-7-phenyl-3,3a,4,5-tetrahydro-1H-indene-2,2-dicarboxylate.
| Compound Name | diethyl (3aR,5R)-5-methyl-6-oxo-7-phenyl-3,3a,4,5-tetrahydro-1H-indene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 100975633 |
| Molecular Formula | C22H26O5 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | diethyl (3aR,5R)-5-methyl-6-oxo-7-phenyl-3,3a,4,5-tetrahydro-1H-indene-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC2=C(c3ccccc3)C(=O)[C@H](C)C[C@@H]2C1 |
| InChI | InChI=1S/C22H26O5/c1-4-26-20(24)22(21(25)27-5-2)12-16-11-14(3)19(23)18(17(16)13-22)15-9-7-6-8-10-15/h6-10,14,16H,4-5,11-13H2,1-3H3/t14-,16-/m1/s1 |
| InChIKey | UVKLJGBOPAICNK-GDBMZVCRSA-N |
| XLogP | 3.57 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|