C32H36O5 — CID 71663386
diethyl (1R)-8-butyl-2-oxo-1,3-diphenyl-1,4,6,7-tetrahydroazulene-5,5-dicarboxylate (PubChem CID 71663386) has the molecular formula C32H36O5 and a molecular weight of 500.64 g/mol. Its IUPAC name is diethyl (1R)-8-butyl-2-oxo-1,3-diphenyl-1,4,6,7-tetrahydroazulene-5,5-dicarboxylate.
| Compound Name | diethyl (1R)-8-butyl-2-oxo-1,3-diphenyl-1,4,6,7-tetrahydroazulene-5,5-dicarboxylate |
|---|---|
| PubChem CID | 71663386 |
| Molecular Formula | C32H36O5 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | diethyl (1R)-8-butyl-2-oxo-1,3-diphenyl-1,4,6,7-tetrahydroazulene-5,5-dicarboxylate |
| SMILES | CCCCC1=C2C(=C(c3ccccc3)C(=O)[C@@H]2c2ccccc2)CC(C(=O)OCC)(C(=O)OCC)CC1 |
| InChI | InChI=1S/C32H36O5/c1-4-7-14-24-19-20-32(30(34)36-5-2,31(35)37-6-3)21-25-26(24)28(23-17-12-9-13-18-23)29(33)27(25)22-15-10-8-11-16-22/h8-13,15-18,28H,4-7,14,19-21H2,1-3H3/t28-/m1/s1 |
| InChIKey | OXCUMQAUYWZJKF-MUUNZHRXSA-N |
| XLogP | 6.59 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|