C20H21BrO5 — CID 100937132
diethyl 6-(4-bromophenyl)-5-oxo-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate (PubChem CID 100937132) has the molecular formula C20H21BrO5 and a molecular weight of 421.29 g/mol. Its IUPAC name is diethyl 6-(4-bromophenyl)-5-oxo-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate.
| Compound Name | diethyl 6-(4-bromophenyl)-5-oxo-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 100937132 |
| Molecular Formula | C20H21BrO5 |
| Molecular Weight | 421.29 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | diethyl 6-(4-bromophenyl)-5-oxo-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC2=C(c3ccc(Br)cc3)C(=O)CC2C1 |
| InChI | InChI=1S/C20H21BrO5/c1-3-25-18(23)20(19(24)26-4-2)10-13-9-16(22)17(15(13)11-20)12-5-7-14(21)8-6-12/h5-8,13H,3-4,9-11H2,1-2H3 |
| InChIKey | IJYIZKDTVBGMNR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.29 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|