C21H21F3O5 — CID 101037660
diethyl (3aR)-5-oxo-6-[4-(trifluoromethyl)phenyl]-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate (PubChem CID 101037660) has the molecular formula C21H21F3O5 and a molecular weight of 410.39 g/mol. Its IUPAC name is diethyl (3aR)-5-oxo-6-[4-(trifluoromethyl)phenyl]-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate.
| Compound Name | diethyl (3aR)-5-oxo-6-[4-(trifluoromethyl)phenyl]-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 101037660 |
| Molecular Formula | C21H21F3O5 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | diethyl (3aR)-5-oxo-6-[4-(trifluoromethyl)phenyl]-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC2=C(c3ccc(C(F)(F)F)cc3)C(=O)C[C@H]2C1 |
| InChI | InChI=1S/C21H21F3O5/c1-3-28-18(26)20(19(27)29-4-2)10-13-9-16(25)17(15(13)11-20)12-5-7-14(8-6-12)21(22,23)24/h5-8,13H,3-4,9-11H2,1-2H3/t13-/m0/s1 |
| InChIKey | RDGWMUBPCOOYPC-ZDUSSCGKSA-N |
| XLogP | 3.95 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|