C26H25F3O7 — CID 132539457
trimethyl (2R,3R,4S)-4-phenacyl-2-[4-(trifluoromethyl)phenyl]cyclopentane-1,1,3-tricarboxylate (PubChem CID 132539457) has the molecular formula C26H25F3O7 and a molecular weight of 506.47 g/mol. Its IUPAC name is trimethyl (2R,3R,4S)-4-phenacyl-2-[4-(trifluoromethyl)phenyl]cyclopentane-1,1,3-tricarboxylate.
| Compound Name | trimethyl (2R,3R,4S)-4-phenacyl-2-[4-(trifluoromethyl)phenyl]cyclopentane-1,1,3-tricarboxylate |
|---|---|
| PubChem CID | 132539457 |
| Molecular Formula | C26H25F3O7 |
| Molecular Weight | 506.47 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | trimethyl (2R,3R,4S)-4-phenacyl-2-[4-(trifluoromethyl)phenyl]cyclopentane-1,1,3-tricarboxylate |
| SMILES | COC(=O)[C@@H]1[C@H](CC(=O)c2ccccc2)CC(C(=O)OC)(C(=O)OC)[C@H]1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H25F3O7/c1-34-22(31)20-17(13-19(30)15-7-5-4-6-8-15)14-25(23(32)35-2,24(33)36-3)21(20)16-9-11-18(12-10-16)26(27,28)29/h4-12,17,20-21H,13-14H2,1-3H3/t17-,20-,21+/m1/s1 |
| InChIKey | NETLWWISLFYSHI-UIFIKXQLSA-N |
| XLogP | 4.20 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|