C22H16O4 — CID 118723716
3-[4-(hydroxymethyl)phenyl]-4-phenyl-1-oxaspiro[4.5]deca-3,6,9-triene-2,8-dione (PubChem CID 118723716) has the molecular formula C22H16O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is 3-[4-(hydroxymethyl)phenyl]-4-phenyl-1-oxaspiro[4.5]deca-3,6,9-triene-2,8-dione.
| Compound Name | 3-[4-(hydroxymethyl)phenyl]-4-phenyl-1-oxaspiro[4.5]deca-3,6,9-triene-2,8-dione |
|---|---|
| PubChem CID | 118723716 |
| Molecular Formula | C22H16O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 3-[4-(hydroxymethyl)phenyl]-4-phenyl-1-oxaspiro[4.5]deca-3,6,9-triene-2,8-dione |
| SMILES | O=C1C=CC2(C=C1)OC(=O)C(c1ccc(CO)cc1)=C2c1ccccc1 |
| InChI | InChI=1S/C22H16O4/c23-14-15-6-8-16(9-7-15)19-20(17-4-2-1-3-5-17)22(26-21(19)25)12-10-18(24)11-13-22/h1-13,23H,14H2 |
| InChIKey | BCUSKIUTSKAPCI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|