C21H13NO5 — CID 154714925
4-(4-nitrophenyl)-3-phenyl-1-oxaspiro[4.5]deca-3,6,9-triene-2,8-dione (PubChem CID 154714925) has the molecular formula C21H13NO5 and a molecular weight of 359.34 g/mol. Its IUPAC name is 4-(4-nitrophenyl)-3-phenyl-1-oxaspiro[4.5]deca-3,6,9-triene-2,8-dione.
| Compound Name | 4-(4-nitrophenyl)-3-phenyl-1-oxaspiro[4.5]deca-3,6,9-triene-2,8-dione |
|---|---|
| PubChem CID | 154714925 |
| Molecular Formula | C21H13NO5 |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 4-(4-nitrophenyl)-3-phenyl-1-oxaspiro[4.5]deca-3,6,9-triene-2,8-dione |
| SMILES | O=C1C=CC2(C=C1)OC(=O)C(c1ccccc1)=C2c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H13NO5/c23-17-10-12-21(13-11-17)19(15-6-8-16(9-7-15)22(25)26)18(20(24)27-21)14-4-2-1-3-5-14/h1-13H |
| InChIKey | VMDCIOJCVGXRIQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|