C14H13NO5 — CID 137352979
7a-methyl-3-(4-nitrophenyl)-5,6-dihydro-4H-furo[2,3-b]pyran-2-one (PubChem CID 137352979) has the molecular formula C14H13NO5 and a molecular weight of 275.26 g/mol. Its IUPAC name is 7a-methyl-3-(4-nitrophenyl)-5,6-dihydro-4H-furo[2,3-b]pyran-2-one.
| Compound Name | 7a-methyl-3-(4-nitrophenyl)-5,6-dihydro-4H-furo[2,3-b]pyran-2-one |
|---|---|
| PubChem CID | 137352979 |
| Molecular Formula | C14H13NO5 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 7a-methyl-3-(4-nitrophenyl)-5,6-dihydro-4H-furo[2,3-b]pyran-2-one |
| SMILES | CC12OCCCC1=C(c1ccc([N+](=O)[O-])cc1)C(=O)O2 |
| InChI | InChI=1S/C14H13NO5/c1-14-11(3-2-8-19-14)12(13(16)20-14)9-4-6-10(7-5-9)15(17)18/h4-7H,2-3,8H2,1H3 |
| InChIKey | GQVBILJKGZRUHO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|