About (1R,5R)-5-methyl-1,7-bis(4-nitrophenyl)-8-oxabicyclo[3.2.1]oct-6-en-2-one
(1R,5R)-5-methyl-1,7-bis(4-nitrophenyl)-8-oxabicyclo[3.2.1]oct-6-en-2-one (PubChem CID 11111686) has the molecular formula C20H16N2O6
and a molecular weight of 380.36 g/mol. Its IUPAC name is (1R,5R)-5-methyl-1,7-bis(4-nitrophenyl)-8-oxabicyclo[3.2.1]oct-6-en-2-one.
Molecular Properties
| Compound Name | (1R,5R)-5-methyl-1,7-bis(4-nitrophenyl)-8-oxabicyclo[3.2.1]oct-6-en-2-one |
| PubChem CID | 11111686 |
| Molecular Formula | C20H16N2O6 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | (1R,5R)-5-methyl-1,7-bis(4-nitrophenyl)-8-oxabicyclo[3.2.1]oct-6-en-2-one |
| SMILES | C[C@@]12C=C(c3ccc([N+](=O)[O-])cc3)[C@@](c3ccc([N+](=O)[O-])cc3)(O1)C(=O)CC2 |
| InChI | InChI=1S/C20H16N2O6/c1-19-11-10-18(23)20(28-19,14-4-8-16(9-5-14)22(26)27)17(12-19)13-2-6-15(7-3-13)21(24)25/h2-9,12H,10-11H2,1H3/t19-,20-/m1/s1 |
| InChIKey | DWJYMLWQNVPNSW-WOJBJXKFSA-N |
| XLogP | 3.93 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1R,5R)-5-methyl-1,7-bis(4-nitrophenyl)-8-oxabicyclo[3.2.1]oct-6-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,5R)-5-methyl-1,7-bis(4-nitrophenyl)-8-oxabicyclo[3.2.1]oct-6-en-2-one?
The IUPAC name of (1R,5R)-5-methyl-1,7-bis(4-nitrophenyl)-8-oxabicyclo[3.2.1]oct-6-en-2-one (CID 11111686) is (1R,5R)-5-methyl-1,7-bis(4-nitrophenyl)-8-oxabicyclo[3.2.1]oct-6-en-2-one.
What is the SMILES notation for (1R,5R)-5-methyl-1,7-bis(4-nitrophenyl)-8-oxabicyclo[3.2.1]oct-6-en-2-one?
The canonical SMILES for (1R,5R)-5-methyl-1,7-bis(4-nitrophenyl)-8-oxabicyclo[3.2.1]oct-6-en-2-one is C[C@@]12C=C(c3ccc([N+](=O)[O-])cc3)[C@@](c3ccc([N+](=O)[O-])cc3)(O1)C(=O)CC2.
What is the InChIKey of (1R,5R)-5-methyl-1,7-bis(4-nitrophenyl)-8-oxabicyclo[3.2.1]oct-6-en-2-one?
The InChIKey is DWJYMLWQNVPNSW-WOJBJXKFSA-N. The full InChI is InChI=1S/C20H16N2O6/c1-19-11-10-18(23)20(28-19,14-4-8-16(9-5-14)22(26)27)17(12-19)13-2-6-15(7-3-13)21(24)25/h2-9,12H,10-11H2,1H3/t19-,20-/m1/s1.
What are the key properties of (1R,5R)-5-methyl-1,7-bis(4-nitrophenyl)-8-oxabicyclo[3.2.1]oct-6-en-2-one?
(1R,5R)-5-methyl-1,7-bis(4-nitrophenyl)-8-oxabicyclo[3.2.1]oct-6-en-2-one has a molecular weight of 380.36 g/mol, XLogP of 3.93, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,5R)-5-methyl-1,7-bis(4-nitrophenyl)-8-oxabicyclo[3.2.1]oct-6-en-2-one is sourced from PubChem (CID 11111686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).