C10H9Cl2NO2 — CID 804648
1-[(1S)-2,2-dichloro-1-methylcyclopropyl]-4-nitrobenzene (PubChem CID 804648) has the molecular formula C10H9Cl2NO2 and a molecular weight of 246.09 g/mol. Its IUPAC name is 1-[(1S)-2,2-dichloro-1-methylcyclopropyl]-4-nitrobenzene.
| Compound Name | 1-[(1S)-2,2-dichloro-1-methylcyclopropyl]-4-nitrobenzene |
|---|---|
| PubChem CID | 804648 |
| Molecular Formula | C10H9Cl2NO2 |
| Molecular Weight | 246.09 g/mol |
| Exact Mass | 245.00 |
| IUPAC Name | 1-[(1S)-2,2-dichloro-1-methylcyclopropyl]-4-nitrobenzene |
| SMILES | C[C@@]1(c2ccc([N+](=O)[O-])cc2)CC1(Cl)Cl |
| InChI | InChI=1S/C10H9Cl2NO2/c1-9(6-10(9,11)12)7-2-4-8(5-3-7)13(14)15/h2-5H,6H2,1H3/t9-/m0/s1 |
| InChIKey | NWUVDCMOTQSUME-VIFPVBQESA-N |
| XLogP | 3.43 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.09 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|