C11H13Cl2NO4 — CID 143933657
chloromethane;2-(chloromethyl)-2-(4-nitrophenyl)-1,3-dioxolane (PubChem CID 143933657) has the molecular formula C11H13Cl2NO4 and a molecular weight of 294.13 g/mol. Its IUPAC name is chloromethane;2-(chloromethyl)-2-(4-nitrophenyl)-1,3-dioxolane.
| Compound Name | chloromethane;2-(chloromethyl)-2-(4-nitrophenyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 143933657 |
| Molecular Formula | C11H13Cl2NO4 |
| Molecular Weight | 294.13 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | chloromethane;2-(chloromethyl)-2-(4-nitrophenyl)-1,3-dioxolane |
| SMILES | CCl.O=[N+]([O-])c1ccc(C2(CCl)OCCO2)cc1 |
| InChI | InChI=1S/C10H10ClNO4.CH3Cl/c11-7-10(15-5-6-16-10)8-1-3-9(4-2-8)12(13)14;1-2/h1-4H,5-7H2;1H3 |
| InChIKey | ISQLBJDPYPOQAD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.13 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|