C18H17NO4 — CID 19745114
2-[(E)-3-(4-nitrophenyl)prop-2-enyl]-2-phenyl-1,3-dioxolane (PubChem CID 19745114) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is 2-[(E)-3-(4-nitrophenyl)prop-2-enyl]-2-phenyl-1,3-dioxolane.
| Compound Name | 2-[(E)-3-(4-nitrophenyl)prop-2-enyl]-2-phenyl-1,3-dioxolane |
|---|---|
| PubChem CID | 19745114 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 2-[(E)-3-(4-nitrophenyl)prop-2-enyl]-2-phenyl-1,3-dioxolane |
| SMILES | O=[N+]([O-])c1ccc(/C=C/CC2(c3ccccc3)OCCO2)cc1 |
| InChI | InChI=1S/C18H17NO4/c20-19(21)17-10-8-15(9-11-17)5-4-12-18(22-13-14-23-18)16-6-2-1-3-7-16/h1-11H,12-14H2/b5-4+ |
| InChIKey | AHXWTFVBVHYOPQ-SNAWJCMRSA-N |
| XLogP | 3.90 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|