C11H11Cl3N2O4 — CID 775058
(3R,5S)-5-methoxy-5-(4-nitrophenyl)-3-(trichloromethyl)-1,2-oxazolidine (PubChem CID 775058) has the molecular formula C11H11Cl3N2O4 and a molecular weight of 341.58 g/mol. Its IUPAC name is (3R,5S)-5-methoxy-5-(4-nitrophenyl)-3-(trichloromethyl)-1,2-oxazolidine.
| Compound Name | (3R,5S)-5-methoxy-5-(4-nitrophenyl)-3-(trichloromethyl)-1,2-oxazolidine |
|---|---|
| PubChem CID | 775058 |
| Molecular Formula | C11H11Cl3N2O4 |
| Molecular Weight | 341.58 g/mol |
| Exact Mass | 339.98 |
| IUPAC Name | (3R,5S)-5-methoxy-5-(4-nitrophenyl)-3-(trichloromethyl)-1,2-oxazolidine |
| SMILES | CO[C@@]1(c2ccc([N+](=O)[O-])cc2)C[C@H](C(Cl)(Cl)Cl)NO1 |
| InChI | InChI=1S/C11H11Cl3N2O4/c1-19-10(6-9(15-20-10)11(12,13)14)7-2-4-8(5-3-7)16(17)18/h2-5,9,15H,6H2,1H3/t9-,10+/m1/s1 |
| InChIKey | LTXHOJYGXHNJGE-ZJUUUORDSA-N |
| XLogP | 3.06 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.58 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|