About 1-(4-nitrophenyl)-3,6-diazatricyclo[4.3.1.13,8]undecane
1-(4-nitrophenyl)-3,6-diazatricyclo[4.3.1.13,8]undecane (PubChem CID 623472) has the molecular formula C15H19N3O2
and a molecular weight of 273.34 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-3,6-diazatricyclo[4.3.1.13,8]undecane.
Molecular Properties
| Compound Name | 1-(4-nitrophenyl)-3,6-diazatricyclo[4.3.1.13,8]undecane |
| PubChem CID | 623472 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 1-(4-nitrophenyl)-3,6-diazatricyclo[4.3.1.13,8]undecane |
| SMILES | O=[N+]([O-])c1ccc(C23CC4CN(CCN(C4)C2)C3)cc1 |
| InChI | InChI=1S/C15H19N3O2/c19-18(20)14-3-1-13(2-4-14)15-7-12-8-16(10-15)5-6-17(9-12)11-15/h1-4,12H,5-11H2 |
| InChIKey | OAPJFGWANXKBJX-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-nitrophenyl)-3,6-diazatricyclo[4.3.1.13,8]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-nitrophenyl)-3,6-diazatricyclo[4.3.1.13,8]undecane?
The IUPAC name of 1-(4-nitrophenyl)-3,6-diazatricyclo[4.3.1.13,8]undecane (CID 623472) is 1-(4-nitrophenyl)-3,6-diazatricyclo[4.3.1.13,8]undecane.
What is the SMILES notation for 1-(4-nitrophenyl)-3,6-diazatricyclo[4.3.1.13,8]undecane?
The canonical SMILES for 1-(4-nitrophenyl)-3,6-diazatricyclo[4.3.1.13,8]undecane is O=[N+]([O-])c1ccc(C23CC4CN(CCN(C4)C2)C3)cc1.
What is the InChIKey of 1-(4-nitrophenyl)-3,6-diazatricyclo[4.3.1.13,8]undecane?
The InChIKey is OAPJFGWANXKBJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O2/c19-18(20)14-3-1-13(2-4-14)15-7-12-8-16(10-15)5-6-17(9-12)11-15/h1-4,12H,5-11H2.
What are the key properties of 1-(4-nitrophenyl)-3,6-diazatricyclo[4.3.1.13,8]undecane?
1-(4-nitrophenyl)-3,6-diazatricyclo[4.3.1.13,8]undecane has a molecular weight of 273.34 g/mol, XLogP of 1.48, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-nitrophenyl)-3,6-diazatricyclo[4.3.1.13,8]undecane is sourced from PubChem (CID 623472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).