C15H19N3O2 — CID 623472
1-(4-nitrophenyl)-3,6-diazatricyclo[4.3.1.13,8]undecane (PubChem CID 623472) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-3,6-diazatricyclo[4.3.1.13,8]undecane.
| Compound Name | 1-(4-nitrophenyl)-3,6-diazatricyclo[4.3.1.13,8]undecane |
|---|---|
| PubChem CID | 623472 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 1-(4-nitrophenyl)-3,6-diazatricyclo[4.3.1.13,8]undecane |
| SMILES | O=[N+]([O-])c1ccc(C23CC4CN(CCN(C4)C2)C3)cc1 |
| InChI | InChI=1S/C15H19N3O2/c19-18(20)14-3-1-13(2-4-14)15-7-12-8-16(10-15)5-6-17(9-12)11-15/h1-4,12H,5-11H2 |
| InChIKey | OAPJFGWANXKBJX-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|