C22H23N5O2 — CID 6518445
(Z)-N-[(Z)-(4-nitrophenyl)methylideneamino]-1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-imine (PubChem CID 6518445) has the molecular formula C22H23N5O2 and a molecular weight of 389.46 g/mol. Its IUPAC name is (Z)-N-[(Z)-(4-nitrophenyl)methylideneamino]-1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-imine.
| Compound Name | (Z)-N-[(Z)-(4-nitrophenyl)methylideneamino]-1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-imine |
|---|---|
| PubChem CID | 6518445 |
| Molecular Formula | C22H23N5O2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | (Z)-N-[(Z)-(4-nitrophenyl)methylideneamino]-1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-imine |
| SMILES | O=[N+]([O-])c1ccc(/C=N\N=C2/C3CN4CCN(C3)CC2(c2ccccc2)C4)cc1 |
| InChI | InChI=1S/C22H23N5O2/c28-27(29)20-8-6-17(7-9-20)12-23-24-21-18-13-25-10-11-26(14-18)16-22(21,15-25)19-4-2-1-3-5-19/h1-9,12,18H,10-11,13-16H2/b23-12-,24-21+ |
| InChIKey | OEXJBAQWVNOELX-IIPMIHBHSA-N |
| XLogP | 2.57 |
| TPSA | 74.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|