C23H24N4O5 — CID 547088
1,8-bis[(4-nitrophenyl)methyl]-3,6-diazatricyclo[4.3.1.13,8]undecan-9-one (PubChem CID 547088) has the molecular formula C23H24N4O5 and a molecular weight of 436.47 g/mol. Its IUPAC name is 1,8-bis[(4-nitrophenyl)methyl]-3,6-diazatricyclo[4.3.1.13,8]undecan-9-one.
| Compound Name | 1,8-bis[(4-nitrophenyl)methyl]-3,6-diazatricyclo[4.3.1.13,8]undecan-9-one |
|---|---|
| PubChem CID | 547088 |
| Molecular Formula | C23H24N4O5 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 1,8-bis[(4-nitrophenyl)methyl]-3,6-diazatricyclo[4.3.1.13,8]undecan-9-one |
| SMILES | O=C1C2(Cc3ccc([N+](=O)[O-])cc3)CN3CCN(C2)CC1(Cc1ccc([N+](=O)[O-])cc1)C3 |
| InChI | InChI=1S/C23H24N4O5/c28-21-22(11-17-1-5-19(6-2-17)26(29)30)13-24-9-10-25(14-22)16-23(21,15-24)12-18-3-7-20(8-4-18)27(31)32/h1-8H,9-16H2 |
| InChIKey | VHQXHMVLDNNIBI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|