C8H7I2NO3 — CID 163767908
1-(1,1-diiodoethoxy)-4-nitrobenzene (PubChem CID 163767908) has the molecular formula C8H7I2NO3 and a molecular weight of 418.96 g/mol. Its IUPAC name is 1-(1,1-diiodoethoxy)-4-nitrobenzene.
| Compound Name | 1-(1,1-diiodoethoxy)-4-nitrobenzene |
|---|---|
| PubChem CID | 163767908 |
| Molecular Formula | C8H7I2NO3 |
| Molecular Weight | 418.96 g/mol |
| Exact Mass | 418.85 |
| IUPAC Name | 1-(1,1-diiodoethoxy)-4-nitrobenzene |
| SMILES | CC(I)(I)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C8H7I2NO3/c1-8(9,10)14-7-4-2-6(3-5-7)11(12)13/h2-5H,1H3 |
| InChIKey | MDYFVWGSFFLGQY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.96 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|