About chloromethane;(4-nitrophenyl) formate
chloromethane;(4-nitrophenyl) formate (PubChem CID 143083318) has the molecular formula C8H8ClNO4
and a molecular weight of 217.61 g/mol. Its IUPAC name is chloromethane;(4-nitrophenyl) formate.
Molecular Properties
| Compound Name | chloromethane;(4-nitrophenyl) formate |
| PubChem CID | 143083318 |
| Molecular Formula | C8H8ClNO4 |
| Molecular Weight | 217.61 g/mol |
| Exact Mass | 217.01 |
| IUPAC Name | chloromethane;(4-nitrophenyl) formate |
| SMILES | CCl.O=COc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C7H5NO4.CH3Cl/c9-5-12-7-3-1-6(2-4-7)8(10)11;1-2/h1-5H;1H3 |
| InChIKey | MNPBUWUELLCBJI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.61 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze chloromethane;(4-nitrophenyl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethane;(4-nitrophenyl) formate?
The IUPAC name of chloromethane;(4-nitrophenyl) formate (CID 143083318) is chloromethane;(4-nitrophenyl) formate.
What is the SMILES notation for chloromethane;(4-nitrophenyl) formate?
The canonical SMILES for chloromethane;(4-nitrophenyl) formate is CCl.O=COc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of chloromethane;(4-nitrophenyl) formate?
The InChIKey is MNPBUWUELLCBJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO4.CH3Cl/c9-5-12-7-3-1-6(2-4-7)8(10)11;1-2/h1-5H;1H3.
What are the key properties of chloromethane;(4-nitrophenyl) formate?
chloromethane;(4-nitrophenyl) formate has a molecular weight of 217.61 g/mol, XLogP of 1.99, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethane;(4-nitrophenyl) formate is sourced from PubChem (CID 143083318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).