C15H15N2O4+ — CID 22355119
1-[2-[(4-nitrophenyl)methyl]-1,3-dioxolan-2-yl]pyridin-1-ium (PubChem CID 22355119) has the molecular formula C15H15N2O4+ and a molecular weight of 287.30 g/mol. Its IUPAC name is 1-[2-[(4-nitrophenyl)methyl]-1,3-dioxolan-2-yl]pyridin-1-ium.
| Compound Name | 1-[2-[(4-nitrophenyl)methyl]-1,3-dioxolan-2-yl]pyridin-1-ium |
|---|---|
| PubChem CID | 22355119 |
| Molecular Formula | C15H15N2O4+ |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 1-[2-[(4-nitrophenyl)methyl]-1,3-dioxolan-2-yl]pyridin-1-ium |
| SMILES | O=[N+]([O-])c1ccc(CC2([n+]3ccccc3)OCCO2)cc1 |
| InChI | InChI=1S/C15H15N2O4/c18-17(19)14-6-4-13(5-7-14)12-15(20-10-11-21-15)16-8-2-1-3-9-16/h1-9H,10-12H2/q+1 |
| InChIKey | VKFRRTBKLNBFQL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 65.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|