C20H17NO4 — CID 11121210
(1R,5R)-5-methyl-7-(4-nitrophenyl)-1-phenyl-8-oxabicyclo[3.2.1]oct-6-en-2-one (PubChem CID 11121210) has the molecular formula C20H17NO4 and a molecular weight of 335.36 g/mol. Its IUPAC name is (1R,5R)-5-methyl-7-(4-nitrophenyl)-1-phenyl-8-oxabicyclo[3.2.1]oct-6-en-2-one.
| Compound Name | (1R,5R)-5-methyl-7-(4-nitrophenyl)-1-phenyl-8-oxabicyclo[3.2.1]oct-6-en-2-one |
|---|---|
| PubChem CID | 11121210 |
| Molecular Formula | C20H17NO4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | (1R,5R)-5-methyl-7-(4-nitrophenyl)-1-phenyl-8-oxabicyclo[3.2.1]oct-6-en-2-one |
| SMILES | C[C@@]12C=C(c3ccc([N+](=O)[O-])cc3)[C@@](c3ccccc3)(O1)C(=O)CC2 |
| InChI | InChI=1S/C20H17NO4/c1-19-12-11-18(22)20(25-19,15-5-3-2-4-6-15)17(13-19)14-7-9-16(10-8-14)21(23)24/h2-10,13H,11-12H2,1H3/t19-,20-/m1/s1 |
| InChIKey | PCPVSVVOMPHCRW-WOJBJXKFSA-N |
| XLogP | 4.03 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|