C15H20N2O2 — CID 165485999
N,N,1-trimethyl-4-(4-nitrophenyl)cyclohex-3-en-1-amine (PubChem CID 165485999) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is N,N,1-trimethyl-4-(4-nitrophenyl)cyclohex-3-en-1-amine.
| Compound Name | N,N,1-trimethyl-4-(4-nitrophenyl)cyclohex-3-en-1-amine |
|---|---|
| PubChem CID | 165485999 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | N,N,1-trimethyl-4-(4-nitrophenyl)cyclohex-3-en-1-amine |
| SMILES | CN(C)C1(C)CC=C(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C15H20N2O2/c1-15(16(2)3)10-8-13(9-11-15)12-4-6-14(7-5-12)17(18)19/h4-8H,9-11H2,1-3H3 |
| InChIKey | NLLNUTZVWJUKKL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|