C17H13ClO3 — CID 1294536
(2S)-6-(4-chlorophenyl)-2-methyl-2-phenyl-1,3-dioxin-4-one (PubChem CID 1294536) has the molecular formula C17H13ClO3 and a molecular weight of 300.74 g/mol. Its IUPAC name is (2S)-6-(4-chlorophenyl)-2-methyl-2-phenyl-1,3-dioxin-4-one.
| Compound Name | (2S)-6-(4-chlorophenyl)-2-methyl-2-phenyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 1294536 |
| Molecular Formula | C17H13ClO3 |
| Molecular Weight | 300.74 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | (2S)-6-(4-chlorophenyl)-2-methyl-2-phenyl-1,3-dioxin-4-one |
| SMILES | C[C@@]1(c2ccccc2)OC(=O)C=C(c2ccc(Cl)cc2)O1 |
| InChI | InChI=1S/C17H13ClO3/c1-17(13-5-3-2-4-6-13)20-15(11-16(19)21-17)12-7-9-14(18)10-8-12/h2-11H,1H3/t17-/m0/s1 |
| InChIKey | BBPOANJBAYGMFP-KRWDZBQOSA-N |
| XLogP | 4.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.74 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |