C22H22O4 — CID 11337057
(4R,5S,7R,7aR)-7a-hydroxy-4,5,7-trimethyl-3,7-diphenyl-4,5-dihydrofuro[2,3-c]pyran-2-one (PubChem CID 11337057) has the molecular formula C22H22O4 and a molecular weight of 350.41 g/mol. Its IUPAC name is (4R,5S,7R,7aR)-7a-hydroxy-4,5,7-trimethyl-3,7-diphenyl-4,5-dihydrofuro[2,3-c]pyran-2-one.
| Compound Name | (4R,5S,7R,7aR)-7a-hydroxy-4,5,7-trimethyl-3,7-diphenyl-4,5-dihydrofuro[2,3-c]pyran-2-one |
|---|---|
| PubChem CID | 11337057 |
| Molecular Formula | C22H22O4 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | (4R,5S,7R,7aR)-7a-hydroxy-4,5,7-trimethyl-3,7-diphenyl-4,5-dihydrofuro[2,3-c]pyran-2-one |
| SMILES | C[C@@H]1O[C@](C)(c2ccccc2)[C@]2(O)OC(=O)C(c3ccccc3)=C2[C@H]1C |
| InChI | InChI=1S/C22H22O4/c1-14-15(2)25-21(3,17-12-8-5-9-13-17)22(24)19(14)18(20(23)26-22)16-10-6-4-7-11-16/h4-15,24H,1-3H3/t14-,15-,21+,22+/m0/s1 |
| InChIKey | BTLYQLJGPWPXSO-ZYNNUQKQSA-N |
| XLogP | 3.66 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |