C16H18O3 — CID 11391256
(7S,7aR)-4,5,7-trimethyl-3-phenyl-4,5,7,7a-tetrahydrofuro[2,3-c]pyran-2-one (PubChem CID 11391256) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is (7S,7aR)-4,5,7-trimethyl-3-phenyl-4,5,7,7a-tetrahydrofuro[2,3-c]pyran-2-one.
| Compound Name | (7S,7aR)-4,5,7-trimethyl-3-phenyl-4,5,7,7a-tetrahydrofuro[2,3-c]pyran-2-one |
|---|---|
| PubChem CID | 11391256 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | (7S,7aR)-4,5,7-trimethyl-3-phenyl-4,5,7,7a-tetrahydrofuro[2,3-c]pyran-2-one |
| SMILES | CC1O[C@@H](C)[C@@H]2OC(=O)C(c3ccccc3)=C2C1C |
| InChI | InChI=1S/C16H18O3/c1-9-10(2)18-11(3)15-13(9)14(16(17)19-15)12-7-5-4-6-8-12/h4-11,15H,1-3H3/t9?,10?,11-,15-/m0/s1 |
| InChIKey | KTAAKMUMBBAQIN-VDKCPCOOSA-N |
| XLogP | 2.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |