C13H12O2 — CID 86097455
3-phenyl-4,5,6,6a-tetrahydrocyclopenta[b]furan-2-one (PubChem CID 86097455) has the molecular formula C13H12O2 and a molecular weight of 200.24 g/mol. Its IUPAC name is 3-phenyl-4,5,6,6a-tetrahydrocyclopenta[b]furan-2-one.
| Compound Name | 3-phenyl-4,5,6,6a-tetrahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 86097455 |
| Molecular Formula | C13H12O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 3-phenyl-4,5,6,6a-tetrahydrocyclopenta[b]furan-2-one |
| SMILES | O=C1OC2CCCC2=C1c1ccccc1 |
| InChI | InChI=1S/C13H12O2/c14-13-12(9-5-2-1-3-6-9)10-7-4-8-11(10)15-13/h1-3,5-6,11H,4,7-8H2 |
| InChIKey | KAVUMUUNFOEUAD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |