C21H21NO2 — CID 134960657
(9aR)-3,9-diphenyl-4,5,6,7,8,9a-hexahydrofuro[2,3-b]azocin-2-one (PubChem CID 134960657) has the molecular formula C21H21NO2 and a molecular weight of 319.40 g/mol. Its IUPAC name is (9aR)-3,9-diphenyl-4,5,6,7,8,9a-hexahydrofuro[2,3-b]azocin-2-one.
| Compound Name | (9aR)-3,9-diphenyl-4,5,6,7,8,9a-hexahydrofuro[2,3-b]azocin-2-one |
|---|---|
| PubChem CID | 134960657 |
| Molecular Formula | C21H21NO2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | (9aR)-3,9-diphenyl-4,5,6,7,8,9a-hexahydrofuro[2,3-b]azocin-2-one |
| SMILES | O=C1O[C@@H]2C(=C1c1ccccc1)CCCCCN2c1ccccc1 |
| InChI | InChI=1S/C21H21NO2/c23-21-19(16-10-4-1-5-11-16)18-14-8-3-9-15-22(20(18)24-21)17-12-6-2-7-13-17/h1-2,4-7,10-13,20H,3,8-9,14-15H2/t20-/m1/s1 |
| InChIKey | XJZNGSUQKIZNDH-HXUWFJFHSA-N |
| XLogP | 4.40 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |